CAS 959474-42-1
:Thiodiphosphoric acid ([(HO)2P(S)]2O)
Description:
Thiodiphosphoric acid, with the chemical formula [(HO)2P(S)]2O and CAS number 959474-42-1, is a phosphorus-containing compound characterized by its dual phosphoric acid groups linked by a sulfur atom. This compound exhibits properties typical of phosphoric acids, including the ability to form esters and complexes with various metals. Thiodiphosphoric acid is notable for its potential applications in agriculture as a pesticide or herbicide, owing to its ability to interact with biological systems. It is also of interest in materials science for its role in the synthesis of flame retardants and other specialty chemicals. The presence of sulfur in its structure may impart unique reactivity and stability characteristics compared to other phosphoric acids. Additionally, thiodiphosphoric acid can participate in various chemical reactions, including esterification and phosphorylation, making it a versatile intermediate in organic synthesis. Safety and handling precautions are essential, as with many phosphorus compounds, due to potential toxicity and environmental impact.
Formula:H4O5P2S2
InChI:InChI=1S/H4O5P2S2/c1-6(2,8)5-7(3,4)9/h(H2,1,2,8)(H2,3,4,9)
InChI key:InChIKey=CIFZCCWGXMYJEU-UHFFFAOYSA-N
SMILES:O(P(=O)(O)S)P(=O)(O)S
Synonyms:- Thiopyrophosphoric acids, (HO)2SPOPS(OH)2
- Dithiopyrophosphoric acid
- Thiodiphosphoric acid ([(HO)2P(S)]2O)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1-Dithiopyrophosphoric Acid
CAS:Controlled ProductFormula:H4O5P2S2Color and Shape:NeatMolecular weight:210.106
