CymitQuimica logo

CAS 959515-59-4

:

7-cyclopropyl-2,7-diazaspiro[3.5]nonane

Description:
7-Cyclopropyl-2,7-diazaspiro[3.5]nonane is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring a cyclopropyl group and two nitrogen atoms incorporated into the spiro system. This compound belongs to a class of spiro compounds that exhibit interesting stereochemistry and potential biological activity. The presence of the diaza moiety suggests that it may interact with biological targets, making it of interest in medicinal chemistry. Its spiro structure can influence its conformational flexibility and reactivity, which are important for its potential applications in drug development. The compound is likely to be a solid at room temperature, and its solubility may vary depending on the solvent used. Additionally, the presence of nitrogen atoms can affect its basicity and potential interactions with other molecules. Overall, 7-cyclopropyl-2,7-diazaspiro[3.5]nonane represents a fascinating subject for further research in both synthetic and medicinal chemistry contexts.
Formula:C10H18N2
InChI:InChI=1/C10H18N2/c1-2-9(1)12-5-3-10(4-6-12)7-11-8-10/h9,11H,1-8H2
Synonyms:
  • 7-Cyclopropyl-2,7-diazaspiro[3.5]nonan
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.