CymitQuimica logo

CAS 959573-31-0

:

(αS,βS)-β-Amino-α-hydroxy-2-naphthalenepropanoic acid

Description:
(αS,βS)-β-Amino-α-hydroxy-2-naphthalenepropanoic acid, with CAS number 959573-31-0, is a chiral amino acid derivative characterized by its unique structural features, which include a naphthalene ring system and both amino and hydroxy functional groups. This compound exhibits properties typical of amino acids, such as the ability to form hydrogen bonds and participate in various biochemical reactions. Its chirality, indicated by the (αS,βS) configuration, suggests that it may exhibit specific interactions in biological systems, potentially influencing its activity as a pharmaceutical or biochemical agent. The presence of the naphthalene moiety can contribute to its hydrophobic characteristics, affecting solubility and interaction with biological membranes. Additionally, the compound may serve as a building block in the synthesis of more complex molecules or as a ligand in various chemical reactions. Overall, its structural complexity and functional groups make it a subject of interest in medicinal chemistry and drug design.
Formula:C13H13NO3
InChI:InChI=1S/C13H13NO3/c14-11(12(15)13(16)17)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11-12,15H,14H2,(H,16,17)/t11-,12-/m0/s1
InChI key:InChIKey=XWVSXSUSCGCSFK-RYUDHWBXSA-N
SMILES:[C@H]([C@@H](C(O)=O)O)(N)C1=CC2=C(C=C1)C=CC=C2
Synonyms:
  • (αS,βS)-β-Amino-α-hydroxy-2-naphthalenepropanoic acid
  • 2-Naphthalenepropanoic acid, β-amino-α-hydroxy-, (αS,βS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.