CymitQuimica logo

CAS 959573-34-3

:

(αS,βS)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-α-hydroxy-1-naphthalenepropanoic acid

Description:
The chemical substance known as (αS,βS)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-α-hydroxy-1-naphthalenepropanoic acid, with the CAS number 959573-34-3, is a synthetic compound that belongs to the class of amino acids and derivatives. It features a complex structure characterized by the presence of a naphthalene moiety, which contributes to its aromatic properties, and a fluorenylmethoxycarbonyl (Fmoc) protecting group, commonly used in peptide synthesis to protect amino groups. The compound exhibits both acidic and basic functional groups, allowing it to participate in various chemical reactions, including peptide bond formation. Its stereochemistry, indicated by the (αS,βS) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions. This compound is often utilized in research and development, particularly in the fields of medicinal chemistry and biochemistry, for its potential applications in drug design and synthesis. Its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of interest for further studies.
Formula:C28H23NO5
InChI:InChI=1S/C28H23NO5/c30-26(27(31)32)25(23-15-7-9-17-8-1-2-10-18(17)23)29-28(33)34-16-24-21-13-5-3-11-19(21)20-12-4-6-14-22(20)24/h1-15,24-26,30H,16H2,(H,29,33)(H,31,32)/t25-,26-/m0/s1
InChI key:InChIKey=BUZJFSDHZCMMQV-UIOOFZCWSA-N
SMILES:C(OC(N[C@H]([C@@H](C(O)=O)O)C=1C2=C(C=CC1)C=CC=C2)=O)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyms:
  • 1-Naphthalenepropanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-α-hydroxy-, (αS,βS)-
  • (αS,βS)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-α-hydroxy-1-naphthalenepropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.