
CAS 959576-02-4
:(αS,βS)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-α-hydroxy-4-methylbenzenepropanoic acid
Description:
The chemical substance known as (αS,βS)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-α-hydroxy-4-methylbenzenepropanoic acid, with the CAS number 959576-02-4, is a synthetic compound that features a complex structure characterized by the presence of a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is commonly used in peptide synthesis. This compound contains an amino acid backbone, specifically incorporating a hydroxy group and a methyl-substituted aromatic ring, which contributes to its unique properties. The stereochemistry indicated by the (αS,βS) notation suggests specific spatial arrangements of the chiral centers, which can influence the compound's biological activity and interactions. The presence of both hydrophilic (due to the carboxylic acid and hydroxy groups) and hydrophobic (due to the fluorenyl group) characteristics may affect its solubility and reactivity in various environments. This compound is likely to be of interest in pharmaceutical and biochemical research, particularly in the development of peptide-based therapeutics or as a building block in organic synthesis.
Formula:C25H23NO5
InChI:InChI=1S/C25H23NO5/c1-15-10-12-16(13-11-15)22(23(27)24(28)29)26-25(30)31-14-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21/h2-13,21-23,27H,14H2,1H3,(H,26,30)(H,28,29)/t22-,23-/m0/s1
InChI key:InChIKey=DXEGPGRQLHGCFP-GOTSBHOMSA-N
SMILES:C(OC(N[C@H]([C@@H](C(O)=O)O)C1=CC=C(C)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- Benzenepropanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-α-hydroxy-4-methyl-, (αS,βS)-
- (αS,βS)-β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-α-hydroxy-4-methylbenzenepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2S,3S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-hydroxy-3-(p-tolyl)propanoic acid
CAS:Formula:C25H23NO5Molecular weight:417.4538
