CAS 959578-12-2
:5-Chloro-α,1-dimethyl-3-(trifluoromethyl)-1H-pyrazole-4-methanol
Description:
5-Chloro-α,1-dimethyl-3-(trifluoromethyl)-1H-pyrazole-4-methanol is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a chloro group and a trifluoromethyl group contributes to its unique reactivity and properties. This compound typically exhibits moderate to high polarity due to the hydroxymethyl group, which can participate in hydrogen bonding. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. Additionally, the dimethyl substitution at the α-position can affect the compound's steric and electronic properties, potentially impacting its interaction with biological targets. Overall, this compound may exhibit interesting chemical behavior and biological activity, making it a subject of study in medicinal chemistry and related fields.
Formula:C7H8ClF3N2O
InChI:InChI=1S/C7H8ClF3N2O/c1-3(14)4-5(7(9,10)11)12-13(2)6(4)8/h3,14H,1-2H3
InChI key:InChIKey=SDJZRAZGACHQDT-UHFFFAOYSA-N
SMILES:C(C)(O)C=1C(C(F)(F)F)=NN(C)C1Cl
Synonyms:- 1H-Pyrazole-4-methanol, 5-chloro-α,1-dimethyl-3-(trifluoromethyl)-
- 5-Chloro-α,1-dimethyl-3-(trifluoromethyl)-1H-pyrazole-4-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[5-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]ethan-1-ol
CAS:<p>1-[5-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]ethan-1-ol</p>Molecular weight:228.60g/mol
