CAS 959579-56-7
:1-(1,1-Dimethylethyl) (3S,4R)-4-(3-thienyl)-1,3-pyrrolidinedicarboxylate
Description:
1-(1,1-Dimethylethyl) (3S,4R)-4-(3-thienyl)-1,3-pyrrolidinedicarboxylate is a chemical compound characterized by its unique structural features, including a pyrrolidine ring with two carboxylate groups and a thienyl substituent. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, which can influence its reactivity and interactions with biological targets. The specific stereochemistry indicated by the (3S,4R) configuration suggests that the compound has defined spatial arrangements that may affect its pharmacological properties. This compound may exhibit interesting biological activities, potentially making it a candidate for pharmaceutical applications. Its molecular structure suggests it could participate in various chemical reactions, including esterification and nucleophilic substitutions, due to the presence of the carboxylate groups. Additionally, the thienyl group may impart specific electronic properties, enhancing its interaction with biological molecules. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and drug development.
Formula:C14H19NO4S
InChI:InChI=1S/C14H19NO4S/c1-14(2,3)19-13(18)15-6-10(9-4-5-20-8-9)11(7-15)12(16)17/h4-5,8,10-11H,6-7H2,1-3H3,(H,16,17)/t10-,11+/m0/s1
InChI key:InChIKey=SMFRPIXMKBJZBM-WDEREUQCSA-N
SMILES:C(O)(=O)[C@H]1[C@@H](CN(C(OC(C)(C)C)=O)C1)C=2C=CSC2
Synonyms:- 1-(1,1-Dimethylethyl) (3S,4R)-4-(3-thienyl)-1,3-pyrrolidinedicarboxylate
- 1,3-Pyrrolidinedicarboxylic acid, 4-(3-thienyl)-, 1-(1,1-dimethylethyl) ester, (3S,4R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.