CAS 959579-57-8
:(3S,4S)-4-(Furan-2-yl)pyrrolidine-3-carboxylic acid
Description:
(3S,4S)-4-(Furan-2-yl)pyrrolidine-3-carboxylic acid is a chiral compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of the furan moiety, a five-membered aromatic ring with oxygen, contributes to its unique chemical properties and potential biological activity. This compound features two stereocenters, which are indicated by the (3S,4S) configuration, suggesting specific spatial arrangements that can influence its reactivity and interactions with biological targets. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyrrolidine and furan functionalities, which are often found in biologically active molecules. Its CAS number, 959579-57-8, provides a unique identifier for this substance in chemical databases, facilitating research and communication within the scientific community.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c11-9(12)7-5-10-4-6(7)8-2-1-3-13-8/h1-3,6-7,10H,4-5H2,(H,11,12)/t6-,7-/m1/s1
SMILES:c1cc([C@@H]2CNC[C@H]2C(=O)O)oc1
Synonyms:- (3S,4S)-4-(2-Furyl)pyrrolidine-3-carboxylic acid
- 3-pyrrolidinecarboxylic acid, 4-(2-furanyl)-, (3S,4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.