CAS 959579-75-0

1-(1,1-Dimethylethyl) (3S,4S)-4-(2-furanyl)-1,3-pyrrolidinedicarboxylate

Description:

1-(1,1-Dimethylethyl) (3S,4S)-4-(2-furanyl)-1,3-pyrrolidinedicarboxylate is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a furan group and two carboxylate functionalities. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its steric bulk, potentially influencing its reactivity and solubility. The stereochemistry indicated by the (3S,4S) configuration suggests specific spatial arrangements that may affect the compound's biological activity and interactions with other molecules. This compound may exhibit properties typical of pyrrolidine derivatives, such as potential applications in pharmaceuticals or agrochemicals. Its furan moiety can also impart aromatic characteristics, possibly enhancing its stability and reactivity in various chemical environments. As with many organic compounds, the solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₁₄H₁₉NO₅

InChI: InChI=1S/C14H19NO5/c1-14(2,3)20-13(18)15-7-9(10(8-15)12(16)17)11-5-4-6-19-11/h4-6,9-10H,7-8H2,1-3H3,(H,16,17)/t9-,10-/m1/s1

InChI key: InChIKey=SDSRKQPMFMWNJA-NXEZZACHSA-N

SMILES: C(O)(=O)[C@H]1[C@@H](CN(C(OC(C)(C)C)=O)C1)C2=CC=CO2

Synonyms:

• 1-(1,1-Dimethylethyl) (3S,4S)-4-(2-furanyl)-1,3-pyrrolidinedicarboxylate
• 1,3-Pyrrolidinedicarboxylic acid, 4-(2-furanyl)-, 1-(1,1-dimethylethyl) ester, (3S,4S)-