CAS 959582-09-3

3-(4-Nitrophenyl)-1H-pyrazole-1-acetic acid

Description:

3-(4-Nitrophenyl)-1H-pyrazole-1-acetic acid is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-nitrophenyl group indicates that there is a nitro substituent on the phenyl ring, contributing to the compound's potential reactivity and polarity. The acetic acid moiety suggests that it has acidic properties, which may influence its solubility and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for potential hydrogen bonding and interactions with other molecules, which can be significant in drug design and development. Additionally, the nitro group can serve as a site for further chemical modifications, enhancing its utility in synthetic chemistry. Overall, 3-(4-Nitrophenyl)-1H-pyrazole-1-acetic acid is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₁₁H₉N₃O₄

InChI: InChI=1S/C11H9N3O4/c15-11(16)7-13-6-5-10(12-13)8-1-3-9(4-2-8)14(17)18/h1-6H,7H2,(H,15,16)

InChI key: InChIKey=ITCBOUXODIHCKC-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1N=C(C=C1)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• 1H-Pyrazole-1-acetic acid, 3-(4-nitrophenyl)-
• 3-(4-Nitrophenyl)-1H-pyrazole-1-acetic acid

[3-(4-Nitrophenyl)-1H-pyrazol-1-yl]acetic acid

CAS: 959582-09-3

[3-(4-Nitrophenyl)-1H-pyrazol-1-yl]acetic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 247.21g/mol

Ref: 54-OR9117