CAS 959584-22-6
:4-(Phenylmethyl) hydrogen N-[1-[(1,1-dimethylethoxy)carbonyl]-4-piperidinyl]-L-aspartate
Description:
4-(Phenylmethyl) hydrogen N-[1-[(1,1-dimethylethoxy)carbonyl]-4-piperidinyl]-L-aspartate, with CAS number 959584-22-6, is a chemical compound that belongs to the class of amino acid derivatives. This substance features a complex structure characterized by the presence of an L-aspartate backbone, which is an amino acid known for its role in protein synthesis and metabolism. The compound includes a phenylmethyl group, which contributes to its hydrophobic characteristics, and a piperidine ring that may influence its biological activity and interaction with receptors. The presence of the dimethylethoxycarbonyl group suggests potential for stability and solubility in organic solvents. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its unique structural features could also influence its reactivity and interactions with biological systems, warranting further investigation into its potential applications in drug development or as a biochemical tool.
Formula:C21H30N2O6
InChI:InChI=1S/C21H30N2O6/c1-21(2,3)29-20(27)23-11-9-16(10-12-23)22-17(19(25)26)13-18(24)28-14-15-7-5-4-6-8-15/h4-8,16-17,22H,9-14H2,1-3H3,(H,25,26)/t17-/m0/s1
InChI key:InChIKey=ZTJBISISEKLNRJ-KRWDZBQOSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(N[C@@H](CC(OCC2=CC=CC=C2)=O)C(O)=O)CC1
Synonyms:- 4-(Phenylmethyl) hydrogen N-[1-[(1,1-dimethylethoxy)carbonyl]-4-piperidinyl]-L-aspartate
- L-Aspartic acid, N-[1-[(1,1-dimethylethoxy)carbonyl]-4-piperidinyl]-, 4-(phenylmethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.