CAS 959585-44-5

methyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate

Description:

Methyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a boron-containing dioxaborolane moiety. This compound typically exhibits properties associated with both organic and organoboron chemistry, making it of interest in various synthetic applications, particularly in medicinal chemistry and material science. The presence of the dioxaborolane group suggests potential reactivity in cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. Additionally, the methyl ester functional group contributes to its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The compound's molecular structure allows for potential applications in drug development and as a building block in organic synthesis. Overall, its characteristics make it a versatile compound in both academic research and industrial applications.

Formula: C₁₂H₁₉BN₂O₄

InChI: InChI=1/C12H19BN2O4/c1-11(2)12(3,4)19-13(18-11)9-6-14-15(7-9)8-10(16)17-5/h6-7H,8H2,1-5H3

SMILES: CC1(C)C(C)(C)OB(c2cnn(c2)CC(=O)OC)O1

1-(Methoxycarbonylmethyl)pyrazole-4-boronic acid pinacol ester

CAS: 959585-44-5

Formula: C₁₂H₁₉BN₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.1013

Ref: IN-DA00IJOE

Methyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)acetate

CAS: 959585-44-5

Methyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)acetate

Purity: 95%

Molecular weight: 266.10g/mol

Ref: 54-OR361684

Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-acetate

CAS: 959585-44-5

Formula: C₁₂H₁₉BN₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.1

Ref: 10-F225291