CAS 959617-18-6

5-Methoxy-4-methyl-2-pyridinecarboxaldehyde

Description:

5-Methoxy-4-methyl-2-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) attached to the pyridine ring, as well as an aldehyde functional group (-CHO) at the 2-position. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The methoxy group can enhance the compound's solubility in organic solvents, while the aldehyde group is reactive and can participate in various chemical reactions, such as condensation and oxidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could lead to the development of new therapeutic agents. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₈H₉NO₂

InChI: InChI=1S/C8H9NO2/c1-6-3-7(5-10)9-4-8(6)11-2/h3-5H,1-2H3

InChI key: InChIKey=CAIYSTFLJYBPRM-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(C)=C(OC)C=N1

Synonyms:

• 5-Methoxy-4-methyl-2-pyridinecarboxaldehyde
• 2-Pyridinecarboxaldehyde, 5-methoxy-4-methyl-