CAS 95962-95-1
:1H-imidazole-4-carbothioamide
Description:
1H-imidazole-4-carbothioamide, with the CAS number 95962-95-1, is a heterocyclic organic compound characterized by its imidazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carbothioamide functional group, which consists of a carbonyl group (C=O) bonded to a sulfur atom (S) and an amine (NH2) group. The presence of these functional groups imparts unique chemical properties, including potential reactivity in nucleophilic substitution and coordination chemistry. 1H-imidazole-4-carbothioamide is often studied for its biological activity, particularly in the context of medicinal chemistry, where it may exhibit antimicrobial or antifungal properties. Additionally, its structural characteristics allow for interactions with metal ions, making it of interest in coordination chemistry. The compound is typically soluble in polar solvents, and its stability can be influenced by environmental factors such as pH and temperature. Overall, 1H-imidazole-4-carbothioamide serves as a valuable compound in various chemical and biological research applications.
Formula:C4H5N3S
InChI:InChI=1/C4H5N3S/c5-4(8)3-1-6-2-7-3/h1-2H,(H2,5,8)(H,6,7)
SMILES:c1c(C(=N)S)[nH]cn1
Synonyms:- 1H-imidazole-5-carbothioamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazole-4-thiocarboxamide
CAS:Formula:C4H5N3SPurity:97%Color and Shape:SolidMolecular weight:127.16761H-Imidazole-4-thiocarboxamide
CAS:1H-Imidazole-4-thiocarboxamide
Formula:C4H5N3SPurity:95%Color and Shape: brown powderMolecular weight:127.17g/mol1H-Imidazole-4-carbothioamide
CAS:1H-Imidazole-4-carbothioamide is a compound that has been identified as a lead for drug discovery, with the potential to be used in the treatment of diseases such as cancer and Alzheimer's. The compound has been shown to bind to the protein beta-secretase and inhibit its activity, which may prevent Alzheimer's disease from progressing. 1H-Imidazole-4-carbothioamide has also been shown to bind to an enzyme called lipoxygenase, which is found in cells that cause inflammation. This binding prevents the formation of inflammatory compounds known as leukotrienes and prostaglandins.
Formula:C4H5N3SPurity:Min. 95%Molecular weight:127.17 g/mol



