CymitQuimica logo

CAS 959698-44-3

:

bis(trifluoromethylsulfonyl)azanide; tributyl(2-methoxyethyl)phosphonium

Description:
Bis(trifluoromethylsulfonyl)azanide, also known as tributyl(2-methoxyethyl)phosphonium, is a chemical compound characterized by its unique structure and properties. It features a phosphonium cation, which is a positively charged ion containing a phosphorus atom bonded to three butyl groups and one 2-methoxyethyl group. The presence of the trifluoromethylsulfonyl group contributes to its high polarity and potential as a strong ionic liquid. This compound is typically stable under ambient conditions but may exhibit reactivity under specific circumstances, particularly in the presence of strong nucleophiles or bases. Its solubility in polar solvents makes it useful in various applications, including as an electrolyte in electrochemical systems and in organic synthesis. The trifluoromethylsulfonyl moiety enhances its thermal stability and can impart unique electronic properties, making it of interest in materials science and catalysis. Overall, this compound exemplifies the intersection of organic and inorganic chemistry, showcasing the versatility of phosphonium salts in modern chemical applications.
Formula:C17H34F6NO5PS2
InChI:InChI=1/C15H34OP.C2F6NO4S2/c1-5-8-12-17(13-9-6-2,14-10-7-3)15-11-16-4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-15H2,1-4H3;/q+1;-1
InChI key:QFLRMCUVYQFPCO-UHFFFAOYSA-N
SMILES:CCCC[P+](CCCC)(CCCC)CCOC.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
Found 5 products.