CAS 95970-08-4

1,4-dibromo-2-methoxybenzene

Description:

1,4-Dibromo-2-methoxybenzene, also known as 2-methoxy-1,4-dibromobenzene, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms and one methoxy group. The bromine atoms are positioned at the 1 and 4 positions of the benzene ring, while the methoxy group (-OCH3) is located at the 2 position, leading to a specific arrangement of substituents that influences its chemical properties. This compound is typically a colorless to pale yellow solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. It exhibits moderate reactivity due to the presence of the bromine atoms, which can participate in nucleophilic substitution reactions. Additionally, the methoxy group can influence the compound's reactivity and polarity. 1,4-Dibromo-2-methoxybenzene is used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.

Formula: C₇H₆Br₂O

InChI: InChI=1/C7H6Br2O/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,1H3

SMILES: COc1cc(ccc1Br)Br

Synonyms:

• 2,5-Dibromophenyl methyl ether
• Benzene, 1,4-Dibromo-2-Methoxy-
• 2,5-Dibromoanisole

Benzene, 1,​4-​dibromo-​2-​methoxy-

CAS: 95970-08-4

Formula: C₇H₆Br₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 265.9299

Ref: IN-DA00IJOX

2,5-Dibromoanisole

CAS: 95970-08-4

2,5-Dibromoanisole

Purity: 98%

Molecular weight: 265.93g/mol

Ref: 54-OR75564

2,5-Dibromoanisole

CAS: 95970-08-4

Formula: C₇H₆Br₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 265.932

Ref: 10-F062592