CAS 95970-10-8

1,2,4-Tribromo-5-methoxybenzene

Description:

1,2,4-Tribromo-5-methoxybenzene is an organic compound characterized by its brominated aromatic structure. It features three bromine atoms attached to the benzene ring at the 1, 2, and 4 positions, along with a methoxy group (-OCH3) at the 5 position. This compound is typically a solid at room temperature and is known for its potential applications in various fields, including organic synthesis and materials science. The presence of multiple bromine substituents enhances its reactivity, making it useful in electrophilic substitution reactions. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its solubility and reactivity. Due to its halogenated nature, 1,2,4-tribromo-5-methoxybenzene may exhibit unique physical and chemical properties, such as increased density and potential environmental persistence. Safety considerations should be taken into account when handling this compound, as brominated compounds can pose health risks and environmental concerns.

Formula: C₇H₅Br₃O

InChI: InChI=1S/C7H5Br3O/c1-11-7-3-5(9)4(8)2-6(7)10/h2-3H,1H3

InChI key: InChIKey=VHOBLUDHUKOSAT-UHFFFAOYSA-N

SMILES: O(C)C1=C(Br)C=C(Br)C(Br)=C1

Synonyms:

• 2,4,5-Tribromoanisole
• Benzene, 1,2,4-tribromo-5-methoxy-
• 1,2,4-Tribromo-5-methoxybenzene
• 2,4,5-Tribromo-1-methoxybenzene
• NSC 134564