CAS 959755-98-7

4-Bromo-N-methyl-2-thiazolecarboxamide

Description:

4-Bromo-N-methyl-2-thiazolecarboxamide is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a bromine atom at the 4-position of the thiazole ring contributes to its reactivity and potential biological activity. The N-methyl group indicates that a methyl group is attached to the nitrogen atom of the amide functional group, which can influence the compound's solubility and interaction with biological targets. This compound is typically used in research and may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would depend on the context of its use. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Bromo-N-methyl-2-thiazolecarboxamide is of interest in medicinal chemistry and material science due to its unique structural features.

Formula: C₅H₅BrN₂OS

InChI: InChI=1S/C5H5BrN2OS/c1-7-4(9)5-8-3(6)2-10-5/h2H,1H3,(H,7,9)

InChI key: InChIKey=RYMODSDVCSIADM-UHFFFAOYSA-N

SMILES: C(NC)(=O)C1=NC(Br)=CS1

Synonyms:

• 4-Bromo-N-methyl-2-thiazolecarboxamide
• 2-Thiazolecarboxamide, 4-bromo-N-methyl-