CAS 95980-02-2

7-methyl-2-phenylimidazo[1,2-a]pyrimidin-5-ol

Description:

7-Methyl-2-phenylimidazo[1,2-a]pyrimidin-5-ol is a heterocyclic organic compound characterized by its fused imidazole and pyrimidine rings, which contribute to its unique chemical properties. This compound features a methyl group at the 7-position and a phenyl group at the 2-position of the imidazo ring, enhancing its aromatic character and potentially influencing its biological activity. The presence of a hydroxyl group at the 5-position adds to its reactivity and solubility in polar solvents. This compound is of interest in medicinal chemistry due to its structural similarity to various bioactive molecules, which may suggest potential pharmacological properties. Its CAS number, 95980-02-2, allows for easy identification in chemical databases. The compound's stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature, making it important to consider these factors in practical applications. Overall, 7-methyl-2-phenylimidazo[1,2-a]pyrimidin-5-ol represents a significant structure for further research in drug development and chemical synthesis.

Formula: C₁₃H₁₁N₃O

InChI: InChI=1/C13H11N3O/c1-9-7-12(17)16-8-11(15-13(16)14-9)10-5-3-2-4-6-10/h2-8,17H,1H3

SMILES: Cc1cc(n2cc(c3ccccc3)nc2n1)O

7-Methyl-2-phenylimidazo[1,2-a]pyrimidin-5-ol

CAS: 95980-02-2

7-Methyl-2-phenylimidazo[1,2-a]pyrimidin-5-ol

Purity: 95%

Molecular weight: 225.25g/mol

Ref: 54-OR32338