
CAS 959850-25-0
:1H-Phosphole, 1-fluoro-2,3-dihydro-, 1-oxide
Description:
1H-Phosphole, 1-fluoro-2,3-dihydro-, 1-oxide, identified by its CAS number 959850-25-0, is a heterocyclic compound featuring a five-membered ring containing phosphorus and nitrogen atoms. This compound is characterized by the presence of a phosphole ring, which is a cyclic structure that includes a phosphorus atom and exhibits unique electronic properties due to the presence of the phosphorus atom. The "1-fluoro" designation indicates the presence of a fluorine substituent, which can influence the compound's reactivity and stability. The "2,3-dihydro" notation suggests that the compound has two hydrogen atoms added to the ring, indicating a saturated form of the phosphole. Additionally, the "1-oxide" designation indicates the presence of an oxygen atom bonded to the phosphorus, which can affect the compound's chemical behavior and potential applications. Overall, this compound may exhibit interesting properties relevant to materials science and organic synthesis, although specific applications would depend on further research and characterization.
Formula:C4H6FOP
InChI:InChI=1S/C4H6FOP/c5-7(6)3-1-2-4-7/h1,3H,2,4H2
InChI key:InChIKey=QGQIXHLSZQLGPC-UHFFFAOYSA-N
SMILES:FP1(=O)CCC=C1
Synonyms:- 1H-Phosphole, 1-fluoro-2,3-dihydro-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.