CymitQuimica logo

CAS 959957-78-9

:

1-[[(5-Bromo-3-pyridinyl)oxy]methyl]-N-methylcyclopropanamine

Description:
1-[[(5-Bromo-3-pyridinyl)oxy]methyl]-N-methylcyclopropanamine, with the CAS number 959957-78-9, is a chemical compound characterized by its unique structural features. It contains a cyclopropanamine moiety, which is a three-membered cyclic amine, and a pyridine ring substituted with a bromine atom and a methoxy group. The presence of the bromine atom enhances its reactivity and potential biological activity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Additionally, the pyridine ring contributes to its aromatic character, which can influence its solubility and interaction with biological targets. The compound may be of interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of new therapeutic agents. However, specific biological activity, toxicity, and environmental impact would require further investigation through experimental studies. Overall, this compound represents a class of organic molecules that could have significant implications in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H13BrN2O
InChI:InChI=1S/C10H13BrN2O/c1-12-10(2-3-10)7-14-9-4-8(11)5-13-6-9/h4-6,12H,2-3,7H2,1H3
InChI key:InChIKey=BQFVUGBLBHLOMF-UHFFFAOYSA-N
SMILES:C(OC=1C=C(Br)C=NC1)C2(NC)CC2
Synonyms:
  • Cyclopropanamine, 1-[[(5-bromo-3-pyridinyl)oxy]methyl]-N-methyl-
  • 1-[[(5-Bromopyridin-3-yl)oxy]methyl]-N-methylcyclopropan-1-amine
  • 1-[[(5-Bromo-3-pyridinyl)oxy]methyl]-N-methylcyclopropanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.