
CAS 959957-87-0
:1-[[(6-Chloro-3-pyridinyl)oxy]methyl]cyclopropanamine
Description:
1-[[(6-Chloro-3-pyridinyl)oxy]methyl]cyclopropanamine is a chemical compound characterized by its unique structural features, which include a cyclopropanamine core and a chlorinated pyridine moiety. The presence of the chloro group on the pyridine ring enhances its reactivity and potential biological activity. The compound contains an ether linkage, indicated by the oxy group, which connects the pyridine to the cyclopropanamine structure. This configuration may influence its solubility, stability, and interaction with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many compounds featuring heterocycles and functional groups, it may exhibit interesting pharmacological profiles, warranting further investigation into its therapeutic potential.
Formula:C9H11ClN2O
InChI:InChI=1S/C9H11ClN2O/c10-8-2-1-7(5-12-8)13-6-9(11)3-4-9/h1-2,5H,3-4,6,11H2
InChI key:InChIKey=KRFOQOGWOIHCHT-UHFFFAOYSA-N
SMILES:C(OC=1C=CC(Cl)=NC1)C2(N)CC2
Synonyms:- 1-[[(6-Chloro-3-pyridinyl)oxy]methyl]cyclopropanamine
- 1-[[(6-Chloropyridin-3-yl)oxy]methyl]cyclopropan-1-amine
- Cyclopropanamine, 1-[[(6-chloro-3-pyridinyl)oxy]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(((6-Chloropyridin-3-yl)oxy)methyl)cyclopropanamine
CAS:Formula:C9H11ClN2OMolecular weight:198.6494
