CAS 959957-88-1
:1-[[(6-Bromo-3-pyridinyl)oxy]methyl]cyclopropanamine
Description:
1-[[(6-Bromo-3-pyridinyl)oxy]methyl]cyclopropanamine, with the CAS number 959957-88-1, is a chemical compound characterized by its unique structural features. It contains a cyclopropanamine moiety, which is a three-membered cyclic amine, contributing to its potential reactivity and biological activity. The presence of a bromine atom on the pyridine ring enhances its lipophilicity and may influence its interaction with biological targets. The methylene bridge linking the pyridine to the cyclopropanamine suggests potential for hydrogen bonding and steric interactions, which can affect its pharmacokinetic properties. This compound may exhibit specific biological activities, making it of interest in medicinal chemistry and drug development. Its structural complexity allows for various modifications, which can lead to derivatives with enhanced efficacy or selectivity. As with many compounds in this category, understanding its solubility, stability, and reactivity under different conditions is crucial for its application in research and potential therapeutic uses.
Formula:C9H11BrN2O
InChI:InChI=1S/C9H11BrN2O/c10-8-2-1-7(5-12-8)13-6-9(11)3-4-9/h1-2,5H,3-4,6,11H2
InChI key:InChIKey=AVHVSUSDHDTTPI-UHFFFAOYSA-N
SMILES:C(OC=1C=CC(Br)=NC1)C2(N)CC2
Synonyms:- 1-[[(6-Bromo-3-pyridinyl)oxy]methyl]cyclopropanamine
- Cyclopropanamine, 1-[[(6-bromo-3-pyridinyl)oxy]methyl]-
- 1-[[(6-Bromopyridin-3-yl)oxy]methyl]cyclopropan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
