CymitQuimica logo

CAS 959957-92-7

:

1-methylazetidin-3-amine

Description:
1-Methylazetidin-3-amine, with the CAS number 959957-92-7, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a methyl group at the nitrogen atom and an amino group at the third carbon of the azetidine ring contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents, which is common for amines due to their ability to form hydrogen bonds. The compound may exhibit basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its potential applications may span across pharmaceuticals and agrochemicals, where it can serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C4H10N2
InChI:InChI=1/C4H10N2/c1-6-2-4(5)3-6/h4H,2-3,5H2,1H3
InChI key:BIWZYRJXBPPLLA-UHFFFAOYSA-N
SMILES:CN1CC(C1)N
Found 4 products.