CAS 95998-70-2

1-chloro-2-[(4-chlorophenyl)-difluoro-methyl]-4-(trifluoromethyl)benzene

Description:

1-Chloro-2-[(4-chlorophenyl)-difluoro-methyl]-4-(trifluoromethyl)benzene, with the CAS number 95998-70-2, is an organic compound characterized by its complex aromatic structure. It features multiple halogen substituents, including chlorine and fluorine, which significantly influence its chemical properties and reactivity. The presence of the trifluoromethyl group and difluoromethyl group enhances its lipophilicity, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The compound is likely to exhibit high thermal stability due to the strength of the carbon-fluorine bonds. Additionally, the chlorinated aromatic system may impart unique electronic properties, affecting its behavior in chemical reactions. As with many halogenated compounds, it is essential to consider its environmental impact and potential toxicity, particularly in terms of persistence and bioaccumulation. Overall, this compound exemplifies the complexity and utility of halogenated aromatic compounds in chemical synthesis and industrial applications.

Formula: C₁₄H₇Cl₂F₅

InChI: InChI=1/C14H7Cl2F5/c15-10-4-1-8(2-5-10)13(17,18)11-7-9(14(19,20)21)3-6-12(11)16/h1-7H

SMILES: c1cc(ccc1C(c1cc(ccc1Cl)C(F)(F)F)(F)F)Cl