CAS 959990-37-5
:4-Chloro-2,6-dimethoxy-1,5-naphthyridine
Description:
4-Chloro-2,6-dimethoxy-1,5-naphthyridine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of chlorine and methoxy groups significantly influences its chemical properties and reactivity. The chlorine atom, being an electronegative substituent, can enhance the compound's electrophilic character, while the methoxy groups can provide electron-donating effects, potentially affecting its solubility and interaction with biological targets. This compound may exhibit interesting pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. Additionally, the presence of multiple functional groups can lead to diverse reactivity patterns, including nucleophilic substitutions and electrophilic aromatic substitutions. As with many heterocycles, the stability and reactivity of 4-Chloro-2,6-dimethoxy-1,5-naphthyridine can be influenced by environmental factors such as pH and solvent polarity. Overall, this compound represents a valuable scaffold for further chemical exploration and potential applications in various fields.
Formula:C10H9ClN2O2
InChI:InChI=1S/C10H9ClN2O2/c1-14-8-4-3-7-10(13-8)6(11)5-9(12-7)15-2/h3-5H,1-2H3
InChI key:InChIKey=XGJVYCQQSBFNIO-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(OC)C1)C=CC(OC)=N2
Synonyms:- 1,5-Naphthyridine, 4-chloro-2,6-dimethoxy-
- 4-Chloro-2,6-dimethoxy-1,5-naphthyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
