CAS 959992-79-1

2-Cyclopropyl-4-fluorobenzoic acid

Description:

2-Cyclopropyl-4-fluorobenzoic acid is an aromatic carboxylic acid characterized by its unique structure, which includes a cyclopropyl group and a fluorine atom attached to a benzoic acid framework. The presence of the cyclopropyl group contributes to its distinct steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. The fluorine atom, known for its electronegativity, can enhance the compound's lipophilicity and stability, making it an interesting candidate in medicinal chemistry. This compound may exhibit various biological activities, including anti-inflammatory or analgesic properties, depending on its specific interactions with biological systems. Its solubility and stability in different solvents can vary, which is crucial for its application in pharmaceuticals or agrochemicals. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its structure and purity. Overall, 2-Cyclopropyl-4-fluorobenzoic acid represents a valuable compound for research and development in various chemical and pharmaceutical applications.

Formula: C₁₀H₉FO₂

InChI: InChI=1S/C10H9FO2/c11-7-3-4-8(10(12)13)9(5-7)6-1-2-6/h3-6H,1-2H2,(H,12,13)

InChI key: InChIKey=ILZHOPCOIVKLDI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(F)C=C1)C2CC2

Synonyms:

• Benzoic acid, 2-cyclopropyl-4-fluoro-
• 2-Cyclopropyl-4-fluorobenzoic acid

2-Cyclopropyl-4-fluorobenzoic acid

CAS: 959992-79-1

Versatile small molecule scaffold

Formula: C₁₀H₉FO₂

Purity: Min. 95%

Molecular weight: 180.17 g/mol

Ref: 3D-JNB99279