CAS 96-07-1
:2-(1-Methylethyl)cyclohexanol
Description:
2-(1-Methylethyl)cyclohexanol, also known as isopropylcyclohexanol, is an organic compound characterized by its cyclohexane ring substituted with a hydroxyl group and an isopropyl group. It is a colorless to pale yellow liquid with a characteristic odor. The presence of the hydroxyl (-OH) group classifies it as an alcohol, which contributes to its solubility in polar solvents and its ability to participate in hydrogen bonding. This compound has a relatively low boiling point and moderate volatility, making it useful in various applications, including as a solvent and in the synthesis of other organic compounds. Its chemical structure allows for potential reactivity in organic reactions, such as dehydration and oxidation. Additionally, 2-(1-Methylethyl)cyclohexanol is of interest in the study of fragrance and flavor chemistry due to its pleasant scent profile. Safety data indicates that, like many organic solvents, it should be handled with care to avoid inhalation or skin contact.
Formula:C9H18O
InChI:InChI=1S/C9H18O/c1-7(2)8-5-3-4-6-9(8)10/h7-10H,3-6H2,1-2H3
InChI key:InChIKey=IXVGVVQGNQZQGD-UHFFFAOYSA-N
SMILES:C(C)(C)C1C(O)CCCC1
Synonyms:- (1S,2R)-2-isopropylcyclohexanol
- 2-(1-Methylethyl)cyclohexanol
- 2-(Propan-2-Yl)Cyclohexanol
- 2-(Propan-2-yl)cyclohexan-1-ol
- 2-Propan-2-ylcyclohexan-1-ol
- Cyclohexanol, 2-(1-methylethyl)-
- Cyclohexanol, 2-isopropyl-
- NSC 2330
- 2-Isopropylcyclohexanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Propan-2-yl)cyclohexan-1-ol
CAS:Formula:C9H18OPurity:98%Color and Shape:SolidMolecular weight:142.23862-Isopropylcyclohexan-1-ol
CAS:2-Isopropylcyclohexan-1-ol is a nonpolar organic compound with a high boiling point. It is used in the industrial production of β-lactam antibiotics, such as cephalosporins and carbapenems. The synthesis of 2-isopropylcyclohexanol involves an asymmetric process that produces two enantiomers. One enantiomer can be converted to an α-hydroxy acid (2-isopropylmalic acid) and the other to a β hydroxy acid (2-isobutyric acid). 2-Isopropylcyclohexan-1-ol is also used in chromatographic science as a solute for column chromatography. It has been shown that magnesium sulfate can be used to increase the separation efficiency of 2-isopropylcyclohexanol, which may be because it increases the adsorption of this solute on silicaFormula:C9H18OPurity:Min. 95%Molecular weight:142.24 g/mol


