CAS 96-61-7
:N-Butyl-4-chloro-3-nitrobenzenesulfonamide
Description:
N-Butyl-4-chloro-3-nitrobenzenesulfonamide, with the CAS number 96-61-7, is a chemical compound that belongs to the class of sulfonamides. It features a sulfonamide functional group, which is characterized by the presence of a sulfonyl (SO2) moiety attached to an amine. This compound has a butyl group, which contributes to its hydrophobic characteristics, and a nitro group, which can influence its reactivity and biological activity. The presence of chlorine and nitro substituents on the aromatic ring can enhance its potential as a pharmaceutical agent or as a reagent in organic synthesis. N-Butyl-4-chloro-3-nitrobenzenesulfonamide is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties make it of interest in various applications, including medicinal chemistry and agrochemicals. However, handling precautions should be observed due to potential toxicity associated with sulfonamide compounds.
Formula:C10H13ClN2O4S
InChI:InChI=1/C10H13ClN2O4S/c1-2-3-6-12-18(16,17)8-4-5-9(11)10(7-8)13(14)15/h4-5,7,12H,2-3,6H2,1H3
InChI key:InChIKey=LODDEMCQPHNFSJ-UHFFFAOYSA-N
SMILES:S(NCCCC)(=O)(=O)C1=CC(N(=O)=O)=C(Cl)C=C1
Synonyms:- 202-520-5
- Benzenesulfonamide, N-butyl-4-chloro-3-nitro-
- NSC 166884
- N-Butyl-4-chloro-3-nitrobenzenesulfonamide
- 4chloro3nitroNbutylbenzenesulfonamide
- 4-chloro-3-nitrobenzenesulfonyl butylamine
- N-butyl-4-chloro-3-nitrobenzenesulphonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.