CAS 96-84-4
:Iophenoxic acid
Description:
Iophenoxic acid, with the CAS number 96-84-4, is a chemical compound primarily known for its use in medical imaging, particularly in radiology as a contrast agent. It is classified as an aromatic carboxylic acid, characterized by its phenolic structure, which contributes to its solubility and reactivity. The compound typically appears as a white to off-white crystalline powder and is soluble in organic solvents while having limited solubility in water. Iophenoxic acid is notable for its ability to enhance the contrast of X-ray images, allowing for better visualization of internal structures during diagnostic procedures. Its chemical formula includes functional groups that facilitate its interaction with biological tissues, making it effective in imaging applications. Additionally, it is important to handle Iophenoxic acid with care, as with many chemical substances, due to potential health risks associated with exposure. Overall, Iophenoxic acid plays a significant role in the field of medical diagnostics, contributing to improved patient outcomes through enhanced imaging techniques.
Formula:C11H11I3O3
InChI:InChI=1S/C11H11I3O3/c1-2-5(11(16)17)3-6-7(12)4-8(13)10(15)9(6)14/h4-5,15H,2-3H2,1H3,(H,16,17)
InChI key:InChIKey=GOIQOQCNFWYSTQ-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)CC)C1=C(I)C(O)=C(I)C=C1I
Synonyms:- α-Ethyl-3-hydroxy-2,4,6-triiodohydrocinnamic acid
- α-Ethyl-β-(3-hydroxy-2,4,6-triiodophenyl)propionic acid
- α-Ethyl-3-hydroxy-2,4,6-triiodobenzenepropanoic acid
- Benzenepropanoic acid, α-ethyl-3-hydroxy-2,4,6-triiodo-
- Hydrocinnamic acid, α-ethyl-3-hydroxy-2,4,6-triiodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
