CAS 96-94-6
:2,4-Bis(1-methylbutyl)phenol
Description:
2,4-Bis(1-methylbutyl)phenol, with the CAS number 96-94-6, is an organic compound characterized by its phenolic structure, which features two 1-methylbutyl groups attached to the 2 and 4 positions of a phenol ring. This compound is typically a viscous liquid or solid at room temperature and is known for its hydrophobic properties due to the bulky alkyl substituents. It exhibits antioxidant properties, making it useful in various industrial applications, particularly in the stabilization of polymers and plastics against oxidative degradation. The presence of the hydroxyl (-OH) group contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and etherification. Additionally, 2,4-Bis(1-methylbutyl)phenol is often evaluated for its environmental impact and potential toxicity, as many phenolic compounds can pose risks to aquatic life and human health. Proper handling and disposal measures are essential when working with this substance in laboratory or industrial settings.
Formula:C16H26O
InChI:InChI=1S/C16H26O/c1-5-7-12(3)14-9-10-16(17)15(11-14)13(4)8-6-2/h9-13,17H,5-8H2,1-4H3
InChI key:InChIKey=QEVQVYGCTVKSER-UHFFFAOYSA-N
SMILES:C(CCC)(C)C1=CC(C(CCC)C)=CC=C1O
Synonyms:- Phenol, 2,4-bis(1-methylbutyl)-
- 2,4-Bis(1-methylbutyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
