CymitQuimica logo

CAS 960119-20-4

:

2,2-difluoro-2-(5-isoquinolyl)ethanamine

Description:
2,2-Difluoro-2-(5-isoquinolyl)ethanamine is a chemical compound characterized by its unique structure, which includes a difluoroethylamine moiety and an isoquinoline ring. This compound features two fluorine atoms attached to the carbon adjacent to the amine group, which can influence its reactivity and biological activity. The isoquinoline portion contributes to its potential pharmacological properties, as isoquinolines are known to exhibit a variety of biological activities, including antitumor and neuroprotective effects. The presence of the difluoromethyl group may enhance lipophilicity, potentially affecting the compound's ability to cross biological membranes. Additionally, the compound's amine functional group can participate in hydrogen bonding, which may be relevant in interactions with biological targets. Overall, 2,2-difluoro-2-(5-isoquinolyl)ethanamine is of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. However, specific properties such as solubility, melting point, and stability would require empirical data for comprehensive characterization.
Formula:C11H10F2N2
InChI:InChI=1/C11H10F2N2/c12-11(13,7-14)10-3-1-2-8-6-15-5-4-9(8)10/h1-6H,7,14H2
SMILES:c1cc2cnccc2c(c1)C(CN)(F)F
Synonyms:
  • 2,2-Difluoro-2-(Isoquinolin-5-Yl)Ethanamine
  • 5-Isoquinolineethanamine, Β,Β-Difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.