CAS 96014-55-0

(S)-4-[[(tert-Butoxy)carbonyl]amino]-5-[[(tert-butyl)dimethylsilyl]oxy]pentanoic acid methyl ester

Description:

The chemical substance known as (S)-4-[[(tert-Butoxy)carbonyl]amino]-5-[[(tert-butyl)dimethylsilyl]oxy]pentanoic acid methyl ester, with CAS number 96014-55-0, is an amino acid derivative characterized by its complex structure that includes a tert-butoxycarbonyl (Boc) protecting group and a tert-butyl dimethylsilyl (TBDMS) ether. This compound features a pentanoic acid backbone, which contributes to its amphiphilic nature, making it potentially useful in various biochemical applications, including peptide synthesis and drug formulation. The presence of the Boc group provides stability and protection for the amino functionality during synthetic processes, while the TBDMS group enhances solubility and protects the hydroxyl group. The stereochemistry indicated by the (S) designation suggests that the molecule has a specific spatial arrangement, which is crucial for its biological activity. Overall, this compound is of interest in organic synthesis and medicinal chemistry due to its functional groups and potential applications in the development of pharmaceuticals.

Formula: C₁₇H₃₅NO₅Si

InChI: InChI=1/C17H35NO5Si/c1-16(2,3)23-15(20)18-13(10-11-14(19)21-7)12-22-24(8,9)17(4,5)6/h13H,10-12H2,1-9H3,(H,18,20)/t13-/m0/s1

SMILES: CC(C)(C)OC(=N[C@@H](CCC(=O)OC)CO[Si](C)(C)C(C)(C)C)O