
CAS 960198-62-3
:2-(2-Fluorophenyl)-5-pyrimidinecarbonitrile
Description:
2-(2-Fluorophenyl)-5-pyrimidinecarbonitrile is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a fluorophenyl group. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. This compound features a cyano group (-C≡N) attached to the pyrimidine, which can contribute to its biological activity and make it a candidate for various applications in medicinal chemistry. The molecular structure suggests that it may exhibit interesting pharmacological properties, possibly acting as an inhibitor or modulator in biological systems. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic and heterocyclic rings. Overall, 2-(2-Fluorophenyl)-5-pyrimidinecarbonitrile is of interest in research and development, particularly in the fields of drug discovery and material science.
Formula:C11H6FN3
InChI:InChI=1S/C11H6FN3/c12-10-4-2-1-3-9(10)11-14-6-8(5-13)7-15-11/h1-4,6-7H
InChI key:InChIKey=BFZXYORCKKOSFH-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1)C=2N=CC(C#N)=CN2
Synonyms:- 5-Pyrimidinecarbonitrile, 2-(2-fluorophenyl)-
- 2-(2-Fluorophenyl)-5-pyrimidinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.