CAS 960235-23-8

Ethyl 5-(hydroxymethyl)-2-thiazolecarboxylate

Description:

Ethyl 5-(hydroxymethyl)-2-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a hydroxymethyl group, which contributes to its reactivity and potential applications in organic synthesis. The ethyl ester functional group enhances its solubility in organic solvents, making it useful in various chemical reactions. The presence of the carboxylate moiety suggests that it may participate in esterification or other reactions typical of carboxylic acids and their derivatives. Ethyl 5-(hydroxymethyl)-2-thiazolecarboxylate may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its unique structure allows for various modifications, which can lead to the development of compounds with specific properties or activities. As with many thiazole derivatives, it may also display interesting electronic properties due to the conjugation within the ring system. Overall, this compound represents a versatile building block in synthetic organic chemistry.

Formula: C₇H₉NO₃S

InChI: InChI=1S/C7H9NO3S/c1-2-11-7(10)6-8-3-5(4-9)12-6/h3,9H,2,4H2,1H3

InChI key: InChIKey=YGIRUQYIONZQIR-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(CO)=CN1

Synonyms:

• 2-Thiazolecarboxylic acid, 5-(hydroxymethyl)-, ethyl ester
• Ethyl 5-(hydroxymethyl)-2-thiazolecarboxylate