CAS 960249-93-8

Methyl 2-(difluoromethoxy)-6-fluorobenzoate

Description:

Methyl 2-(difluoromethoxy)-6-fluorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety and multiple fluorine substituents. The presence of the difluoromethoxy group introduces significant polarity and can influence the compound's reactivity and solubility. This compound typically exhibits a low to moderate boiling point due to its molecular weight and structure, and it is likely to be a colorless to pale yellow liquid or solid at room temperature. The fluorine atoms enhance the compound's stability and can affect its interaction with biological systems, making it of interest in pharmaceutical applications. Additionally, the presence of the ester functional group suggests that it may undergo hydrolysis under certain conditions, leading to the release of methanol and the corresponding acid. Overall, Methyl 2-(difluoromethoxy)-6-fluorobenzoate is notable for its unique combination of functional groups, which can impart distinctive chemical properties and potential applications in various fields, including medicinal chemistry and agrochemicals.

Formula: C₉H₇F₃O₃

InChI: InChI=1S/C9H7F3O3/c1-14-8(13)7-5(10)3-2-4-6(7)15-9(11)12/h2-4,9H,1H3

InChI key: InChIKey=AVZXGEUXPCUKRZ-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=C(C(OC)=O)C(F)=CC=C1

Synonyms:

• Methyl 2-(difluoromethoxy)-6-fluorobenzoate
• Benzoic acid, 2-(difluoromethoxy)-6-fluoro-, methyl ester
• 2-Fluoro-6-difluoromethoxybenzoic acid methyl ester