CAS 96027-84-8
:[4-(2-bromoethoxy)-3,5-diiodophenyl](2-butyl-1-benzofuran-3-yl)methanone
Description:
The chemical substance known as [4-(2-bromoethoxy)-3,5-diiodophenyl](2-butyl-1-benzofuran-3-yl)methanone, with the CAS number 96027-84-8, is a complex organic compound characterized by its unique structural features. It contains a benzofuran moiety, which contributes to its potential biological activity, and a phenyl ring substituted with both bromo and iodo groups, enhancing its reactivity and possibly its pharmacological properties. The presence of the butyl group adds hydrophobic characteristics, which can influence its solubility and interaction with biological membranes. The compound's functional groups suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the halogen substituents may impart specific electronic properties, affecting the compound's reactivity and stability. Overall, this substance exemplifies the intricate relationship between molecular structure and biological activity, making it a subject of interest in chemical research and drug development.
Formula:C21H19BrI2O3
InChI:InChI=1/C21H19BrI2O3/c1-2-3-7-18-19(14-6-4-5-8-17(14)27-18)20(25)13-11-15(23)21(16(24)12-13)26-10-9-22/h4-6,8,11-12H,2-3,7,9-10H2,1H3
SMILES:CCCCc1c(c2ccccc2o1)C(=O)c1cc(c(c(c1)I)OCCBr)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-n-Butyl-4-[(2-bromoethoxy)-3,5-diiodobenzoyl]benzofuran
CAS:Formula:C21H19BrI2O3Molecular weight:653.09
