CAS 960289-31-0

1,1-Dimethylethyl (3R)-3-[(5-bromo-2-pyridinyl)oxy]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl (3R)-3-[(5-bromo-2-pyridinyl)oxy]-1-piperidinecarboxylate, identified by its CAS number 960289-31-0, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyridine moiety. The presence of the 5-bromo substituent on the pyridine ring contributes to its potential biological activity, possibly influencing its interaction with various biological targets. The dimethyl group attached to the piperidine enhances its steric properties, which may affect its solubility and reactivity. This compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its functional groups suggest potential for hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Overall, the unique combination of structural features in this compound may lead to diverse applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₅H₂₁BrN₂O₃

InChI: InChI=1S/C15H21BrN2O3/c1-15(2,3)21-14(19)18-8-4-5-12(10-18)20-13-7-6-11(16)9-17-13/h6-7,9,12H,4-5,8,10H2,1-3H3/t12-/m1/s1

InChI key: InChIKey=YPNRPUATPKEDPS-GFCCVEGCSA-N

SMILES: O([C@H]1CN(C(OC(C)(C)C)=O)CCC1)C2=CC=C(Br)C=N2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-[(5-bromo-2-pyridinyl)oxy]-, 1,1-dimethylethyl ester, (3R)-
• 1,1-Dimethylethyl (3R)-3-[(5-bromo-2-pyridinyl)oxy]-1-piperidinecarboxylate