CymitQuimica logo

CAS 960289-59-2

:

rel-(3′R,4′R)-[1,3′-Bipyrrolidin]-4′-ol

Description:
The chemical substance known as rel-(3′R,4′R)-[1,3′-Bipyrrolidin]-4′-ol, with the CAS number 960289-59-2, is a chiral compound characterized by its bipyrrolidine structure, which consists of two pyrrolidine rings connected by a carbon-carbon bond. This compound features specific stereochemistry, indicated by the (3′R,4′R) configuration, which plays a crucial role in its biological activity and interactions. The presence of a hydroxyl (-OH) group at the 4′ position contributes to its potential as a functionalized amine, influencing its solubility and reactivity. Such compounds are often studied for their applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The stereochemical configuration can significantly affect the compound's pharmacokinetics and pharmacodynamics, making it an important consideration in drug design. Overall, rel-(3′R,4′R)-[1,3′-Bipyrrolidin]-4′-ol exemplifies the complexity and significance of chiral molecules in chemical and biological systems.
Formula:C8H16N2O
InChI:InChI=1/C8H16N2O/c11-8-6-9-5-7(8)10-3-1-2-4-10/h7-9,11H,1-6H2/t7-,8-/s2
InChI key:InChIKey=XNAZVRGJPIDDOQ-YZYOREDDNA-N
SMILES:O[C@H]1[C@@H](CNC1)N2CCCC2
Synonyms:
  • [1,3′-Bipyrrolidin]-4′-ol, (3′R,4′R)-rel-
  • rel-(3′R,4′R)-[1,3′-Bipyrrolidin]-4′-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.