
CAS 960491-87-6
:(3S)-3-[2-(Trifluoromethyl)phenoxy]pyrrolidine
Description:
(3S)-3-[2-(Trifluoromethyl)phenoxy]pyrrolidine is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered nitrogen-containing ring. The compound features a trifluoromethyl group attached to a phenoxy substituent, contributing to its unique chemical properties. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, making the compound potentially useful in pharmaceutical applications. The stereochemistry indicated by (3S) suggests that the compound has a specific three-dimensional arrangement, which can significantly influence its biological activity and interactions with receptors or enzymes. This compound may exhibit interesting pharmacological properties, and its structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of fluorine atoms often correlates with increased potency and selectivity in drug design. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions under which it is studied or utilized.
Formula:C11H12F3NO
InChI:InChI=1S/C11H12F3NO/c12-11(13,14)9-3-1-2-4-10(9)16-8-5-6-15-7-8/h1-4,8,15H,5-7H2/t8-/m0/s1
InChI key:InChIKey=XNRDRGOBJOHKEX-QMMMGPOBSA-N
SMILES:C(F)(F)(F)C1=C(O[C@H]2CCNC2)C=CC=C1
Synonyms:- (3S)-3-[2-(Trifluoromethyl)phenoxy]pyrrolidine
- Pyrrolidine, 3-[2-(trifluoromethyl)phenoxy]-, (3S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.