CymitQuimica logo

CAS 960535-42-6

:

2-Chloro-6-(phenylmethoxy)benzothiazole

Description:
2-Chloro-6-(phenylmethoxy)benzothiazole is a chemical compound characterized by its unique structure, which includes a benzothiazole core substituted with a chloro group and a phenylmethoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the benzothiazole moiety, which is known for its applications in pharmaceuticals and agrochemicals. The chloro substituent can influence the compound's reactivity and solubility, while the phenylmethoxy group may enhance its lipophilicity, affecting its interaction with biological systems. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, its potential applications could span across medicinal chemistry, where it may serve as a lead compound for drug development or as an intermediate in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C14H10ClNOS
InChI:InChI=1S/C14H10ClNOS/c15-14-16-12-7-6-11(8-13(12)18-14)17-9-10-4-2-1-3-5-10/h1-8H,9H2
InChI key:InChIKey=IIHQDQNLWWRBRM-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=C3C(=CC2)N=C(Cl)S3
Synonyms:
  • 2-Chloro-6-phenylmethoxy-1,3-benzothiazole
  • Benzothiazole, 2-chloro-6-(phenylmethoxy)-
  • 2-Chloro-6-(phenylmethoxy)benzothiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.