CAS 96056-51-8
:2-benzyl-5,5,5-trifluoro-4-oxopentanoic acid
Description:
2-Benzyl-5,5,5-trifluoro-4-oxopentanoic acid is an organic compound characterized by its unique structure, which includes a benzyl group and a trifluoromethyl group attached to a pentanoic acid backbone. The presence of the trifluoromethyl group imparts significant lipophilicity and can influence the compound's reactivity and biological activity. The oxo group (carbonyl) contributes to the acidity of the carboxylic acid functional group, making it a potential candidate for various chemical reactions, including esterification and amidation. This compound may exhibit interesting pharmacological properties due to its structural features, which could be explored in medicinal chemistry. Additionally, its fluorinated nature may enhance metabolic stability and alter its interaction with biological targets. As with many fluorinated compounds, it is essential to consider environmental and safety aspects during handling and application. Overall, 2-benzyl-5,5,5-trifluoro-4-oxopentanoic acid represents a versatile building block in organic synthesis and drug development.
Formula:C12H11F3O3
InChI:InChI=1/C12H11F3O3/c13-12(14,15)10(16)7-9(11(17)18)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,17,18)
SMILES:c1ccc(cc1)CC(CC(=O)C(F)(F)F)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.