CAS 960613-96-1

3-bromo-5-chloro-pyrazolo[1,5-a]pyrimidine

Description:

3-Bromo-5-chloro-pyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 3 and 5 positions, respectively, enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate to high solubility in organic solvents, which is common for halogenated heterocycles. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The molecular structure allows for potential interactions with biological targets, and its halogen substituents can influence lipophilicity and binding affinity. Additionally, the compound's stability under standard laboratory conditions is generally good, although it may be sensitive to strong bases or nucleophiles due to the presence of halogens. Overall, 3-bromo-5-chloro-pyrazolo[1,5-a]pyrimidine is a versatile compound with applications in research and development within the fields of organic and medicinal chemistry.

Formula: C₆H₃BrClN₃

InChI: InChI=1/C6H3BrClN3/c7-4-3-9-11-2-1-5(8)10-6(4)11/h1-3H

SMILES: c1cn2c(c(cn2)Br)nc1Cl

Synonyms:

• 3-Bromo-5-Chloropyrazolo[1,5-A]Pyrimidine
• Pyrazolo[1,5-A]Pyrimidine, 3-Bromo-5-Chloro-

3-Bromo-5-chloropyrazolo[1,5-a]pyrimidine

CAS: 960613-96-1

Formula: C₆H₃BrClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 232.4651

Ref: IN-DA00IJRY

3-Bromo-5-chloropyrazolo[1,5-a]pyrimidine

CAS: 960613-96-1

3-Bromo-5-chloropyrazolo[1,5-a]pyrimidine

Purity: 98%

Color and Shape: Off-White To Yellow Powder

Molecular weight: 232.47g/mol

Ref: 54-OR52223

3-Bromo-5-chloropyrazolo[1,5-a]pyrimidine

CAS: 960613-96-1

Formula: C₆H₃BrClN₃

Purity: 98%

Color and Shape: Yellow powder

Molecular weight: 232.47

Ref: 10-F076771