
CAS 960616-53-9
:1,1-Dimethylethyl 1,8-diazaspiro[5.6]dodecane-1-carboxylate
Description:
1,1-Dimethylethyl 1,8-diazaspiro[5.6]dodecane-1-carboxylate, identified by its CAS number 960616-53-9, is a chemical compound characterized by its unique spirocyclic structure, which includes a dodecane backbone and two nitrogen atoms incorporated into a spiro configuration. This compound features a carboxylate functional group, which contributes to its potential reactivity and solubility properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, potentially influencing its interactions with other molecules. The diazaspiro structure may impart interesting biological activity, making it a candidate for various applications in medicinal chemistry or materials science. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they are not universally defined and can vary based on environmental conditions. Overall, this compound represents a complex organic structure with potential utility in various chemical and pharmaceutical contexts.
Formula:C15H28N2O2
InChI:InChI=1S/C15H28N2O2/c1-14(2,3)19-13(18)17-11-7-5-9-15(17)8-4-6-10-16-12-15/h16H,4-12H2,1-3H3
InChI key:InChIKey=XAJGVXDLOMQPNC-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C2(CCCCNC2)CCCC1
Synonyms:- 1,8-Diazaspiro[5.6]dodecane-1-carboxylic acid, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 1,8-diazaspiro[5.6]dodecane-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
