CAS 96078-22-7

2-[(4-methyl-2-oxo-2H-chromen-6-yl)oxy]propanoic acid

Description:

2-[(4-methyl-2-oxo-2H-chromen-6-yl)oxy]propanoic acid, also known by its CAS number 96078-22-7, is a chemical compound that features a chromenone moiety, which contributes to its aromatic characteristics. This substance is characterized by the presence of a propanoic acid functional group, indicating it has acidic properties. The chromenone structure typically imparts biological activity, making it of interest in various fields, including medicinal chemistry. The compound is likely to exhibit solubility in organic solvents due to its aromatic nature, while the carboxylic acid group may enhance its solubility in polar solvents. Its molecular structure suggests potential interactions with biological systems, possibly influencing enzyme activity or serving as a scaffold for drug development. Additionally, the presence of the methyl and oxo groups can affect its reactivity and stability. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or as a biochemical probe.

Formula: C₁₃H₁₂O₅

InChI: InChI=1/C13H12O5/c1-7-5-12(14)18-11-4-3-9(6-10(7)11)17-8(2)13(15)16/h3-6,8H,1-2H3,(H,15,16)

SMILES: Cc1cc(=O)oc2ccc(cc12)OC(C)C(=O)O

2-[(4-methyl-2-oxo-2H-chromen-6-yl)oxy]propanoic acid

CAS: 96078-22-7

Formula: C₁₃H₁₂O₅

Purity: 95.0%

Molecular weight: 248.234

Ref: 10-F314800