CAS 961-38-6: 2,4,6-Tris(1,1-dimethylethyl)benzenamine
Description:2,4,6-Tris(1,1-dimethylethyl)benzenamine, also known by its CAS number 961-38-6, is an organic compound characterized by its structure, which features a benzene ring substituted with three bulky tert-butyl groups and an amino group. This compound is typically a solid at room temperature and is known for its stability and resistance to oxidation, making it useful in various applications, particularly as an antioxidant in polymers and other materials. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its bulky tert-butyl substituents contribute to steric hindrance, which can influence its reactivity and solubility in organic solvents. Additionally, this compound is often studied for its potential applications in the field of materials science and as a stabilizer in industrial processes. Safety data indicates that it should be handled with care, as with many organic amines, due to potential health hazards associated with exposure.
Formula:C18H31N
InChI:InChI=1S/C18H31N/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9/h10-11H,19H2,1-9H3
InChI key:InChIKey=REJGDSCBQPJPQT-UHFFFAOYSA-N
SMILES:NC=1C(=CC(=CC1C(C)(C)C)C(C)(C)C)C(C)(C)C
- Synonyms:
- 2,4,6-Tris(1,1-dimethylethyl)benzenamine
- 2,4,6-Tris(tert-butyl)aniline
- 2,4,6-Tritert-butylaniline
- Aniline, 2,4,6-tri-tert-butyl-
- Benzenamine, 2,4,6-tris(1,1-dimethylethyl)-
- Tributylaniline
- 2,4,6-Tri-tert-butylaniline
