CymitQuimica logo

CAS 961-88-6

:

4-(3-phenyl-4,5-dihydro-1H-pyrazol-1-yl)benzaldehyde

Description:
4-(3-phenyl-4,5-dihydro-1H-pyrazol-1-yl)benzaldehyde, with the CAS number 961-88-6, is an organic compound characterized by its structure, which features a benzaldehyde group attached to a pyrazole moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water. The presence of both the aldehyde functional group and the pyrazole ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and substitution reactions. Additionally, compounds of this nature may exhibit biological activity, which can be explored in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, making it of interest in pharmaceutical research. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C16H14N2O
InChI:InChI=1/C16H14N2O/c19-12-13-6-8-15(9-7-13)18-11-10-16(17-18)14-4-2-1-3-5-14/h1-9,12H,10-11H2
SMILES:c1ccc(cc1)C1=NN(CC1)c1ccc(cc1)C=O
Synonyms:
  • 4-(3-Phenyl-4,5-dihydro-pyrazol-1-yl)-benzaldehyde
  • Benzaldehyde, 4-(4,5-dihydro-3-phenyl-1H-pyrazol-1-yl)-
  • 4-(3-phenyl-4,5-dihydro-1H-pyrazol-1-yl)benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.