CAS 96100-89-9

5-(dimethylamino)-N,N-bis(2-hydroxyethyl)naphthalene-1-sulfonamide

Description:

5-(Dimethylamino)-N,N-bis(2-hydroxyethyl)naphthalene-1-sulfonamide, with the CAS number 96100-89-9, is a chemical compound characterized by its naphthalene backbone substituted with a sulfonamide group and two hydroxyethyl groups. This compound typically exhibits properties associated with sulfonamides, such as solubility in polar solvents due to the presence of hydroxyl and sulfonamide functional groups. The dimethylamino group contributes to its basicity, potentially influencing its reactivity and interactions in biological systems. The presence of multiple functional groups suggests that it may participate in hydrogen bonding, which can affect its solubility and stability. This compound is often studied for its potential applications in pharmaceuticals or as a dye, given the structural features that may allow for specific interactions with biological targets or materials. Its unique structure may also impart specific optical properties, making it of interest in various chemical and biological research fields.

Formula: C₁₆H₂₂N₂O₄S

InChI: InChI=1/C16H22N2O4S/c1-17(2)15-7-3-6-14-13(15)5-4-8-16(14)23(21,22)18(9-11-19)10-12-20/h3-8,19-20H,9-12H2,1-2H3

SMILES: CN(C)c1cccc2c1cccc2S(=O)(=O)N(CCO)CCO

Dansyl-d6-diethanolamine

Controlled Product

CAS: 96100-89-9

Formula: C₁₆D₆H₁₆N₂O₄S

Color and Shape: Neat

Molecular weight: 344.459

Ref: TR-D178002