CAS 96102-85-1

4-formylbicyclo[2.2.2]octane-1-carboxylic acid

Description:

4-Formylbicyclo[2.2.2]octane-1-carboxylic acid is a bicyclic compound characterized by its unique structural framework, which consists of a bicyclo[2.2.2]octane core with a formyl group (-CHO) and a carboxylic acid group (-COOH) attached to it. This compound features a rigid, three-dimensional structure that can influence its reactivity and interactions with other molecules. The presence of both the aldehyde and carboxylic acid functional groups suggests that it may participate in various chemical reactions, such as condensation and esterification. Additionally, the bicyclic nature of the compound can impart specific steric and electronic properties, making it of interest in organic synthesis and materials science. Its potential applications may extend to pharmaceuticals, agrochemicals, or as intermediates in the synthesis of more complex organic molecules. As with many organic compounds, the solubility, stability, and reactivity can vary depending on the conditions, such as pH and temperature.

Formula: C₁₀H₁₄O₃

InChI: InChI=1/C10H14O3/c11-7-9-1-4-10(5-2-9,6-3-9)8(12)13/h7H,1-6H2,(H,12,13)

SMILES: C1CC2(CCC1(CC2)C=O)C(=O)O

4-Formylbicyclo[2.2.2]octane-1-carboxylic acid

CAS: 96102-85-1

Formula: C₁₀H₁₄O₃

Molecular weight: 182.2164

Ref: IN-DA006SQT

4-Formylbicyclo[2.2.2]octane-1-carboxylic acid

CAS: 96102-85-1

4-Formylbicyclo[2.2.2]octane-1-carboxylic acid

Purity: ≥95%

Molecular weight: 182.22g/mol

Ref: 54-OR350484