CAS 96146-78-0
:1,1-dibutyl-2-cyanoguanidine
Description:
1,1-Dibutyl-2-cyanoguanidine is an organic compound characterized by its guanidine structure, which features two butyl groups and a cyano group attached to the central guanidine moiety. This compound typically appears as a white to off-white solid and is known for its potential applications in various fields, including agriculture and materials science. It exhibits moderate solubility in organic solvents, reflecting its hydrophobic nature due to the butyl substituents. The presence of the cyano group contributes to its reactivity, making it a useful intermediate in organic synthesis. Additionally, 1,1-dibutyl-2-cyanoguanidine may possess biological activity, which warrants careful handling and consideration of safety protocols. Its molecular structure allows for hydrogen bonding, influencing its physical properties such as melting point and boiling point. As with many chemical substances, understanding its characteristics is crucial for its safe and effective application in industrial and research settings.
Formula:C10H20N4
InChI:InChI=1/C10H20N4/c1-3-5-7-14(8-6-4-2)10(12)13-9-11/h3-8H2,1-2H3,(H2,12,13)
SMILES:CCCCN(CCCC)C(=N)NC#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.